C24H18F3N3O5S2 — CID 129115210
4-[2-(1-oxidopyridin-1-ium-3-yl)-4-(trifluoromethyl)phenoxy]-N-(1,3-thiazol-2-yl)-3,4-dihydro-2H-chromene-7-sulfonamide (PubChem CID 129115210) has the molecular formula C24H18F3N3O5S2 and a molecular weight of 549.55 g/mol. Its IUPAC name is 4-[2-(1-oxidopyridin-1-ium-3-yl)-4-(trifluoromethyl)phenoxy]-N-(1,3-thiazol-2-yl)-3,4-dihydro-2H-chromene-7-sulfonamide.
| Compound Name | 4-[2-(1-oxidopyridin-1-ium-3-yl)-4-(trifluoromethyl)phenoxy]-N-(1,3-thiazol-2-yl)-3,4-dihydro-2H-chromene-7-sulfonamide |
|---|---|
| PubChem CID | 129115210 |
| Molecular Formula | C24H18F3N3O5S2 |
| Molecular Weight | 549.55 g/mol |
| Exact Mass | 549.06 |
| IUPAC Name | 4-[2-(1-oxidopyridin-1-ium-3-yl)-4-(trifluoromethyl)phenoxy]-N-(1,3-thiazol-2-yl)-3,4-dihydro-2H-chromene-7-sulfonamide |
| SMILES | O=S(=O)(Nc1nccs1)c1ccc2c(c1)OCCC2Oc1ccc(C(F)(F)F)cc1-c1ccc[n+]([O-])c1 |
| InChI | InChI=1S/C24H18F3N3O5S2/c25-24(26,27)16-3-6-20(19(12-16)15-2-1-9-30(31)14-15)35-21-7-10-34-22-13-17(4-5-18(21)22)37(32,33)29-23-28-8-11-36-23/h1-6,8-9,11-14,21H,7,10H2,(H,28,29) |
| InChIKey | GWAWJEIRJNMXEG-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.55 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|