C32H28F3IN4O2 — CID 129115444
N-[(1S)-1-[3-(3-carbamoyl-4-fluorophenyl)-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]-1-[iodo(phenyl)methyl]pyrrolidine-2-carboxamide (PubChem CID 129115444) has the molecular formula C32H28F3IN4O2 and a molecular weight of 684.50 g/mol. Its IUPAC name is N-[(1S)-1-[3-(3-carbamoyl-4-fluorophenyl)-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]-1-[iodo(phenyl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | N-[(1S)-1-[3-(3-carbamoyl-4-fluorophenyl)-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]-1-[iodo(phenyl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 129115444 |
| Molecular Formula | C32H28F3IN4O2 |
| Molecular Weight | 684.50 g/mol |
| Exact Mass | 684.12 |
| IUPAC Name | N-[(1S)-1-[3-(3-carbamoyl-4-fluorophenyl)-2-pyridinyl]-2-(3,5-difluorophenyl)ethyl]-1-[iodo(phenyl)methyl]pyrrolidine-2-carboxamide |
| SMILES | NC(=O)c1cc(-c2cccnc2[C@H](Cc2cc(F)cc(F)c2)NC(=O)C2CCCN2C(I)c2ccccc2)ccc1F |
| InChI | InChI=1S/C32H28F3IN4O2/c33-22-14-19(15-23(34)18-22)16-27(29-24(8-4-12-38-29)21-10-11-26(35)25(17-21)31(37)41)39-32(42)28-9-5-13-40(28)30(36)20-6-2-1-3-7-20/h1-4,6-8,10-12,14-15,17-18,27-28,30H,5,9,13,16H2,(H2,37,41)(H,39,42)/t27-,28?,30?/m0/s1 |
| InChIKey | GALAVZIJRBPJDO-PNBLDXKVSA-N |
| XLogP | 6.26 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.50 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|