About 1-adamantyl prop-2-enoate;2,2-di(cyclopenten-1-yloxy)ethyl prop-2-enoate
1-adamantyl prop-2-enoate;2,2-di(cyclopenten-1-yloxy)ethyl prop-2-enoate (PubChem CID 129115763) has the molecular formula C28H38O6
and a molecular weight of 470.61 g/mol. Its IUPAC name is 1-adamantyl prop-2-enoate;2,2-di(cyclopenten-1-yloxy)ethyl prop-2-enoate.
Molecular Properties
| Compound Name | 1-adamantyl prop-2-enoate;2,2-di(cyclopenten-1-yloxy)ethyl prop-2-enoate |
| PubChem CID | 129115763 |
| Molecular Formula | C28H38O6 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.27 |
| IUPAC Name | 1-adamantyl prop-2-enoate;2,2-di(cyclopenten-1-yloxy)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OC12CC3CC(CC(C3)C1)C2.C=CC(=O)OCC(OC1=CCCC1)OC1=CCCC1 |
| InChI | InChI=1S/C15H20O4.C13H18O2/c1-2-14(16)17-11-15(18-12-7-3-4-8-12)19-13-9-5-6-10-13;1-2-12(14)15-13-6-9-3-10(7-13)5-11(4-9)8-13/h2,7,9,15H,1,3-6,8,10-11H2;2,9-11H,1,3-8H2 |
| InChIKey | HFOCWCJYZSRNRJ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-adamantyl prop-2-enoate;2,2-di(cyclopenten-1-yloxy)ethyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-adamantyl prop-2-enoate;2,2-di(cyclopenten-1-yloxy)ethyl prop-2-enoate?
The IUPAC name of 1-adamantyl prop-2-enoate;2,2-di(cyclopenten-1-yloxy)ethyl prop-2-enoate (CID 129115763) is 1-adamantyl prop-2-enoate;2,2-di(cyclopenten-1-yloxy)ethyl prop-2-enoate.
What is the SMILES notation for 1-adamantyl prop-2-enoate;2,2-di(cyclopenten-1-yloxy)ethyl prop-2-enoate?
The canonical SMILES for 1-adamantyl prop-2-enoate;2,2-di(cyclopenten-1-yloxy)ethyl prop-2-enoate is C=CC(=O)OC12CC3CC(CC(C3)C1)C2.C=CC(=O)OCC(OC1=CCCC1)OC1=CCCC1.
What is the InChIKey of 1-adamantyl prop-2-enoate;2,2-di(cyclopenten-1-yloxy)ethyl prop-2-enoate?
The InChIKey is HFOCWCJYZSRNRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O4.C13H18O2/c1-2-14(16)17-11-15(18-12-7-3-4-8-12)19-13-9-5-6-10-13;1-2-12(14)15-13-6-9-3-10(7-13)5-11(4-9)8-13/h2,7,9,15H,1,3-6,8,10-11H2;2,9-11H,1,3-8H2.
What are the key properties of 1-adamantyl prop-2-enoate;2,2-di(cyclopenten-1-yloxy)ethyl prop-2-enoate?
1-adamantyl prop-2-enoate;2,2-di(cyclopenten-1-yloxy)ethyl prop-2-enoate has a molecular weight of 470.61 g/mol, XLogP of 5.89, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-adamantyl prop-2-enoate;2,2-di(cyclopenten-1-yloxy)ethyl prop-2-enoate is sourced from PubChem (CID 129115763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).