About 4-(trifluoromethyl)imidazo[1,2-a]quinoxaline
4-(trifluoromethyl)imidazo[1,2-a]quinoxaline (PubChem CID 12911589) has the molecular formula C11H6F3N3
and a molecular weight of 237.18 g/mol. Its IUPAC name is 4-(trifluoromethyl)imidazo[1,2-a]quinoxaline.
Molecular Properties
| Compound Name | 4-(trifluoromethyl)imidazo[1,2-a]quinoxaline |
| PubChem CID | 12911589 |
| Molecular Formula | C11H6F3N3 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.05 |
| IUPAC Name | 4-(trifluoromethyl)imidazo[1,2-a]quinoxaline |
| SMILES | FC(F)(F)c1nc2ccccc2n2ccnc12 |
| InChI | InChI=1S/C11H6F3N3/c12-11(13,14)9-10-15-5-6-17(10)8-4-2-1-3-7(8)16-9/h1-6H |
| InChIKey | YZADBVDIANDKTK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(trifluoromethyl)imidazo[1,2-a]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(trifluoromethyl)imidazo[1,2-a]quinoxaline?
The IUPAC name of 4-(trifluoromethyl)imidazo[1,2-a]quinoxaline (CID 12911589) is 4-(trifluoromethyl)imidazo[1,2-a]quinoxaline.
What is the SMILES notation for 4-(trifluoromethyl)imidazo[1,2-a]quinoxaline?
The canonical SMILES for 4-(trifluoromethyl)imidazo[1,2-a]quinoxaline is FC(F)(F)c1nc2ccccc2n2ccnc12.
What is the InChIKey of 4-(trifluoromethyl)imidazo[1,2-a]quinoxaline?
The InChIKey is YZADBVDIANDKTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6F3N3/c12-11(13,14)9-10-15-5-6-17(10)8-4-2-1-3-7(8)16-9/h1-6H.
What are the key properties of 4-(trifluoromethyl)imidazo[1,2-a]quinoxaline?
4-(trifluoromethyl)imidazo[1,2-a]quinoxaline has a molecular weight of 237.18 g/mol, XLogP of 2.90, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(trifluoromethyl)imidazo[1,2-a]quinoxaline is sourced from PubChem (CID 12911589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).