About 2-(2-hydroxy-4,6-dimethylphenyl)-4-methoxy-3,5-dimethylphenol
2-(2-hydroxy-4,6-dimethylphenyl)-4-methoxy-3,5-dimethylphenol (PubChem CID 129115928) has the molecular formula C17H20O3
and a molecular weight of 272.34 g/mol. Its IUPAC name is 2-(2-hydroxy-4,6-dimethylphenyl)-4-methoxy-3,5-dimethylphenol.
Molecular Properties
| Compound Name | 2-(2-hydroxy-4,6-dimethylphenyl)-4-methoxy-3,5-dimethylphenol |
| PubChem CID | 129115928 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 2-(2-hydroxy-4,6-dimethylphenyl)-4-methoxy-3,5-dimethylphenol |
| SMILES | COc1c(C)cc(O)c(-c2c(C)cc(C)cc2O)c1C |
| InChI | InChI=1S/C17H20O3/c1-9-6-10(2)15(13(18)7-9)16-12(4)17(20-5)11(3)8-14(16)19/h6-8,18-19H,1-5H3 |
| InChIKey | NSTWRIHKVKOTBZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(2-hydroxy-4,6-dimethylphenyl)-4-methoxy-3,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxy-4,6-dimethylphenyl)-4-methoxy-3,5-dimethylphenol?
The IUPAC name of 2-(2-hydroxy-4,6-dimethylphenyl)-4-methoxy-3,5-dimethylphenol (CID 129115928) is 2-(2-hydroxy-4,6-dimethylphenyl)-4-methoxy-3,5-dimethylphenol.
What is the SMILES notation for 2-(2-hydroxy-4,6-dimethylphenyl)-4-methoxy-3,5-dimethylphenol?
The canonical SMILES for 2-(2-hydroxy-4,6-dimethylphenyl)-4-methoxy-3,5-dimethylphenol is COc1c(C)cc(O)c(-c2c(C)cc(C)cc2O)c1C.
What is the InChIKey of 2-(2-hydroxy-4,6-dimethylphenyl)-4-methoxy-3,5-dimethylphenol?
The InChIKey is NSTWRIHKVKOTBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20O3/c1-9-6-10(2)15(13(18)7-9)16-12(4)17(20-5)11(3)8-14(16)19/h6-8,18-19H,1-5H3.
What are the key properties of 2-(2-hydroxy-4,6-dimethylphenyl)-4-methoxy-3,5-dimethylphenol?
2-(2-hydroxy-4,6-dimethylphenyl)-4-methoxy-3,5-dimethylphenol has a molecular weight of 272.34 g/mol, XLogP of 4.01, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxy-4,6-dimethylphenyl)-4-methoxy-3,5-dimethylphenol is sourced from PubChem (CID 129115928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).