C10H15F2N — CID 129116402
(2E,3Z)-N-(2,2-difluoroethyl)-2-ethylidenehexa-3,5-dien-1-amine (PubChem CID 129116402) has the molecular formula C10H15F2N and a molecular weight of 187.23 g/mol. Its IUPAC name is (2E,3Z)-N-(2,2-difluoroethyl)-2-ethylidenehexa-3,5-dien-1-amine.
| Compound Name | (2E,3Z)-N-(2,2-difluoroethyl)-2-ethylidenehexa-3,5-dien-1-amine |
|---|---|
| PubChem CID | 129116402 |
| Molecular Formula | C10H15F2N |
| Molecular Weight | 187.23 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | (2E,3Z)-N-(2,2-difluoroethyl)-2-ethylidenehexa-3,5-dien-1-amine |
| SMILES | C=C/C=C\C(=C/C)CNCC(F)F |
| InChI | InChI=1S/C10H15F2N/c1-3-5-6-9(4-2)7-13-8-10(11)12/h3-6,10,13H,1,7-8H2,2H3/b6-5-,9-4+ |
| InChIKey | MLEIWCJDSZOSHR-CXBDEZGUSA-N |
| XLogP | 2.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.23 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|