C28H23F6NO2 — CID 129116473
(2E)-1-[9,9-bis(3,3,3-trifluoropropyl)fluoren-2-yl]-2-hydroxyimino-2-(2-methylphenyl)ethanone (PubChem CID 129116473) has the molecular formula C28H23F6NO2 and a molecular weight of 519.49 g/mol. Its IUPAC name is (2E)-1-[9,9-bis(3,3,3-trifluoropropyl)fluoren-2-yl]-2-hydroxyimino-2-(2-methylphenyl)ethanone.
| Compound Name | (2E)-1-[9,9-bis(3,3,3-trifluoropropyl)fluoren-2-yl]-2-hydroxyimino-2-(2-methylphenyl)ethanone |
|---|---|
| PubChem CID | 129116473 |
| Molecular Formula | C28H23F6NO2 |
| Molecular Weight | 519.49 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | (2E)-1-[9,9-bis(3,3,3-trifluoropropyl)fluoren-2-yl]-2-hydroxyimino-2-(2-methylphenyl)ethanone |
| SMILES | Cc1ccccc1/C(=N\O)C(=O)c1ccc2c(c1)C(CCC(F)(F)F)(CCC(F)(F)F)c1ccccc1-2 |
| InChI | InChI=1S/C28H23F6NO2/c1-17-6-2-3-7-19(17)24(35-37)25(36)18-10-11-21-20-8-4-5-9-22(20)26(23(21)16-18,12-14-27(29,30)31)13-15-28(32,33)34/h2-11,16,37H,12-15H2,1H3/b35-24+ |
| InChIKey | SKHUXOFMPHFCTF-JWHWKPFMSA-N |
| XLogP | 8.01 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.49 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|