C13H11ClN2O4 — CID 129116628
4-(2-chloro-5-methyl-4-pyridinyl)-2-methoxycarbonylpyrrole-1-carboxylic acid (PubChem CID 129116628) has the molecular formula C13H11ClN2O4 and a molecular weight of 294.69 g/mol. Its IUPAC name is 4-(2-chloro-5-methyl-4-pyridinyl)-2-methoxycarbonylpyrrole-1-carboxylic acid.
| Compound Name | 4-(2-chloro-5-methyl-4-pyridinyl)-2-methoxycarbonylpyrrole-1-carboxylic acid |
|---|---|
| PubChem CID | 129116628 |
| Molecular Formula | C13H11ClN2O4 |
| Molecular Weight | 294.69 g/mol |
| Exact Mass | 294.04 |
| IUPAC Name | 4-(2-chloro-5-methyl-4-pyridinyl)-2-methoxycarbonylpyrrole-1-carboxylic acid |
| SMILES | COC(=O)c1cc(-c2cc(Cl)ncc2C)cn1C(=O)O |
| InChI | InChI=1S/C13H11ClN2O4/c1-7-5-15-11(14)4-9(7)8-3-10(12(17)20-2)16(6-8)13(18)19/h3-6H,1-2H3,(H,18,19) |
| InChIKey | OFHLUZHAVLQFFD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.69 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|