About 3'-(4-bromophenyl)spiro[7,8-dihydro-5H-naphthalene-6,1'-cyclopentane]-2-ol
3'-(4-bromophenyl)spiro[7,8-dihydro-5H-naphthalene-6,1'-cyclopentane]-2-ol (PubChem CID 129116656) has the molecular formula C20H21BrO
and a molecular weight of 357.29 g/mol. Its IUPAC name is 3'-(4-bromophenyl)spiro[7,8-dihydro-5H-naphthalene-6,1'-cyclopentane]-2-ol.
Molecular Properties
| Compound Name | 3'-(4-bromophenyl)spiro[7,8-dihydro-5H-naphthalene-6,1'-cyclopentane]-2-ol |
| PubChem CID | 129116656 |
| Molecular Formula | C20H21BrO |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | 3'-(4-bromophenyl)spiro[7,8-dihydro-5H-naphthalene-6,1'-cyclopentane]-2-ol |
| SMILES | Oc1ccc2c(c1)CCC1(CCC(c3ccc(Br)cc3)C1)C2 |
| InChI | InChI=1S/C20H21BrO/c21-18-4-1-14(2-5-18)17-8-10-20(13-17)9-7-15-11-19(22)6-3-16(15)12-20/h1-6,11,17,22H,7-10,12-13H2 |
| InChIKey | QQSIDLMEJGWARZ-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3'-(4-bromophenyl)spiro[7,8-dihydro-5H-naphthalene-6,1'-cyclopentane]-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3'-(4-bromophenyl)spiro[7,8-dihydro-5H-naphthalene-6,1'-cyclopentane]-2-ol?
The IUPAC name of 3'-(4-bromophenyl)spiro[7,8-dihydro-5H-naphthalene-6,1'-cyclopentane]-2-ol (CID 129116656) is 3'-(4-bromophenyl)spiro[7,8-dihydro-5H-naphthalene-6,1'-cyclopentane]-2-ol.
What is the SMILES notation for 3'-(4-bromophenyl)spiro[7,8-dihydro-5H-naphthalene-6,1'-cyclopentane]-2-ol?
The canonical SMILES for 3'-(4-bromophenyl)spiro[7,8-dihydro-5H-naphthalene-6,1'-cyclopentane]-2-ol is Oc1ccc2c(c1)CCC1(CCC(c3ccc(Br)cc3)C1)C2.
What is the InChIKey of 3'-(4-bromophenyl)spiro[7,8-dihydro-5H-naphthalene-6,1'-cyclopentane]-2-ol?
The InChIKey is QQSIDLMEJGWARZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21BrO/c21-18-4-1-14(2-5-18)17-8-10-20(13-17)9-7-15-11-19(22)6-3-16(15)12-20/h1-6,11,17,22H,7-10,12-13H2.
What are the key properties of 3'-(4-bromophenyl)spiro[7,8-dihydro-5H-naphthalene-6,1'-cyclopentane]-2-ol?
3'-(4-bromophenyl)spiro[7,8-dihydro-5H-naphthalene-6,1'-cyclopentane]-2-ol has a molecular weight of 357.29 g/mol, XLogP of 5.60, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3'-(4-bromophenyl)spiro[7,8-dihydro-5H-naphthalene-6,1'-cyclopentane]-2-ol is sourced from PubChem (CID 129116656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).