C10H17IO4 — CID 129116872
(3R,3aR,6R,6aS)-6a-iodo-6-methoxy-3-propan-2-yloxy-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan (PubChem CID 129116872) has the molecular formula C10H17IO4 and a molecular weight of 328.15 g/mol. Its IUPAC name is (3R,3aR,6R,6aS)-6a-iodo-6-methoxy-3-propan-2-yloxy-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan.
| Compound Name | (3R,3aR,6R,6aS)-6a-iodo-6-methoxy-3-propan-2-yloxy-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan |
|---|---|
| PubChem CID | 129116872 |
| Molecular Formula | C10H17IO4 |
| Molecular Weight | 328.15 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | (3R,3aR,6R,6aS)-6a-iodo-6-methoxy-3-propan-2-yloxy-3,3a,5,6-tetrahydro-2H-furo[3,2-b]furan |
| SMILES | CO[C@@H]1CO[C@@H]2[C@H](OC(C)C)CO[C@@]21I |
| InChI | InChI=1S/C10H17IO4/c1-6(2)15-7-4-14-10(11)8(12-3)5-13-9(7)10/h6-9H,4-5H2,1-3H3/t7-,8-,9-,10-/m1/s1 |
| InChIKey | FISBBJTWEXFFFT-ZYUZMQFOSA-N |
| XLogP | 1.36 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.15 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|