C12H10FNO6 — CID 129117078
3-(5-fluoro-2-nitrophenoxy)-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-6-one (PubChem CID 129117078) has the molecular formula C12H10FNO6 and a molecular weight of 283.21 g/mol. Its IUPAC name is 3-(5-fluoro-2-nitrophenoxy)-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-6-one.
| Compound Name | 3-(5-fluoro-2-nitrophenoxy)-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-6-one |
|---|---|
| PubChem CID | 129117078 |
| Molecular Formula | C12H10FNO6 |
| Molecular Weight | 283.21 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | 3-(5-fluoro-2-nitrophenoxy)-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-6-one |
| SMILES | O=C1COC2C(Oc3cc(F)ccc3[N+](=O)[O-])COC12 |
| InChI | InChI=1S/C12H10FNO6/c13-6-1-2-7(14(16)17)9(3-6)20-10-5-19-11-8(15)4-18-12(10)11/h1-3,10-12H,4-5H2 |
| InChIKey | ZRBKWMWZYFFUHE-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.21 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|