C26H29FN4O6S — CID 129117125
N-[2-[[(3R,6R,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-5-methoxy-7-[(1-oxothiolan-1-ylidene)amino]quinazolin-4-amine (PubChem CID 129117125) has the molecular formula C26H29FN4O6S and a molecular weight of 544.61 g/mol. Its IUPAC name is N-[2-[[(3R,6R,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-5-methoxy-7-[(1-oxothiolan-1-ylidene)amino]quinazolin-4-amine.
| Compound Name | N-[2-[[(3R,6R,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-5-methoxy-7-[(1-oxothiolan-1-ylidene)amino]quinazolin-4-amine |
|---|---|
| PubChem CID | 129117125 |
| Molecular Formula | C26H29FN4O6S |
| Molecular Weight | 544.61 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | N-[2-[[(3R,6R,6aR)-3-methoxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl]oxy]-4-fluorophenyl]-5-methoxy-7-[(1-oxothiolan-1-ylidene)amino]quinazolin-4-amine |
| SMILES | COc1cc(N=S2(=O)CCCC2)cc2ncnc(Nc3ccc(F)cc3O[C@@H]3COC4[C@H](OC)CO[C@@H]43)c12 |
| InChI | InChI=1S/C26H29FN4O6S/c1-33-20-11-16(31-38(32)7-3-4-8-38)10-18-23(20)26(29-14-28-18)30-17-6-5-15(27)9-19(17)37-22-13-36-24-21(34-2)12-35-25(22)24/h5-6,9-11,14,21-22,24-25H,3-4,7-8,12-13H2,1-2H3,(H,28,29,30)/t21-,22-,24?,25-/m1/s1 |
| InChIKey | UTLBWJZPVDYNLA-YFMLKLAXSA-N |
| XLogP | 3.97 |
| TPSA | 113.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.61 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |