About 2-ethylhexyl 5-methylhexanoate
2-ethylhexyl 5-methylhexanoate (PubChem CID 129117635) has the molecular formula C15H30O2
and a molecular weight of 242.40 g/mol. Its IUPAC name is 2-ethylhexyl 5-methylhexanoate.
Molecular Properties
| Compound Name | 2-ethylhexyl 5-methylhexanoate |
| PubChem CID | 129117635 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 2-ethylhexyl 5-methylhexanoate |
| SMILES | CCCCC(CC)COC(=O)CCCC(C)C |
| InChI | InChI=1S/C15H30O2/c1-5-7-10-14(6-2)12-17-15(16)11-8-9-13(3)4/h13-14H,5-12H2,1-4H3 |
| InChIKey | VAPCGHRVXXAOQQ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethylhexyl 5-methylhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexyl 5-methylhexanoate?
The IUPAC name of 2-ethylhexyl 5-methylhexanoate (CID 129117635) is 2-ethylhexyl 5-methylhexanoate.
What is the SMILES notation for 2-ethylhexyl 5-methylhexanoate?
The canonical SMILES for 2-ethylhexyl 5-methylhexanoate is CCCCC(CC)COC(=O)CCCC(C)C.
What is the InChIKey of 2-ethylhexyl 5-methylhexanoate?
The InChIKey is VAPCGHRVXXAOQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O2/c1-5-7-10-14(6-2)12-17-15(16)11-8-9-13(3)4/h13-14H,5-12H2,1-4H3.
What are the key properties of 2-ethylhexyl 5-methylhexanoate?
2-ethylhexyl 5-methylhexanoate has a molecular weight of 242.40 g/mol, XLogP of 4.57, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl 5-methylhexanoate is sourced from PubChem (CID 129117635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).