About (E)-N,N-dimethyl-3-propan-2-ylsulfonylprop-2-en-1-amine
(E)-N,N-dimethyl-3-propan-2-ylsulfonylprop-2-en-1-amine (PubChem CID 129118271) has the molecular formula C8H17NO2S
and a molecular weight of 191.30 g/mol. Its IUPAC name is (E)-N,N-dimethyl-3-propan-2-ylsulfonylprop-2-en-1-amine.
Molecular Properties
| Compound Name | (E)-N,N-dimethyl-3-propan-2-ylsulfonylprop-2-en-1-amine |
| PubChem CID | 129118271 |
| Molecular Formula | C8H17NO2S |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.10 |
| IUPAC Name | (E)-N,N-dimethyl-3-propan-2-ylsulfonylprop-2-en-1-amine |
| SMILES | CC(C)S(=O)(=O)/C=C/CN(C)C |
| InChI | InChI=1S/C8H17NO2S/c1-8(2)12(10,11)7-5-6-9(3)4/h5,7-8H,6H2,1-4H3/b7-5+ |
| InChIKey | FWURKLGMVKLEBD-FNORWQNLSA-N |
| XLogP | 0.88 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (E)-N,N-dimethyl-3-propan-2-ylsulfonylprop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N,N-dimethyl-3-propan-2-ylsulfonylprop-2-en-1-amine?
The IUPAC name of (E)-N,N-dimethyl-3-propan-2-ylsulfonylprop-2-en-1-amine (CID 129118271) is (E)-N,N-dimethyl-3-propan-2-ylsulfonylprop-2-en-1-amine.
What is the SMILES notation for (E)-N,N-dimethyl-3-propan-2-ylsulfonylprop-2-en-1-amine?
The canonical SMILES for (E)-N,N-dimethyl-3-propan-2-ylsulfonylprop-2-en-1-amine is CC(C)S(=O)(=O)/C=C/CN(C)C.
What is the InChIKey of (E)-N,N-dimethyl-3-propan-2-ylsulfonylprop-2-en-1-amine?
The InChIKey is FWURKLGMVKLEBD-FNORWQNLSA-N. The full InChI is InChI=1S/C8H17NO2S/c1-8(2)12(10,11)7-5-6-9(3)4/h5,7-8H,6H2,1-4H3/b7-5+.
What are the key properties of (E)-N,N-dimethyl-3-propan-2-ylsulfonylprop-2-en-1-amine?
(E)-N,N-dimethyl-3-propan-2-ylsulfonylprop-2-en-1-amine has a molecular weight of 191.30 g/mol, XLogP of 0.88, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N,N-dimethyl-3-propan-2-ylsulfonylprop-2-en-1-amine is sourced from PubChem (CID 129118271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).