C14H27F3O4 — CID 129118345
1-[3-(4,4-dimethylpentoxy)-2-hydroxypropoxy]-4,4,4-trifluorobutan-1-ol (PubChem CID 129118345) has the molecular formula C14H27F3O4 and a molecular weight of 316.36 g/mol. Its IUPAC name is 1-[3-(4,4-dimethylpentoxy)-2-hydroxypropoxy]-4,4,4-trifluorobutan-1-ol.
| Compound Name | 1-[3-(4,4-dimethylpentoxy)-2-hydroxypropoxy]-4,4,4-trifluorobutan-1-ol |
|---|---|
| PubChem CID | 129118345 |
| Molecular Formula | C14H27F3O4 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 1-[3-(4,4-dimethylpentoxy)-2-hydroxypropoxy]-4,4,4-trifluorobutan-1-ol |
| SMILES | CC(C)(C)CCCOCC(O)COC(O)CCC(F)(F)F |
| InChI | InChI=1S/C14H27F3O4/c1-13(2,3)6-4-8-20-9-11(18)10-21-12(19)5-7-14(15,16)17/h11-12,18-19H,4-10H2,1-3H3 |
| InChIKey | NKZOKNRSFOABAN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|