C23H36O5 — CID 129118366
3-[(1S,2S,5S,7R,10R,11S,13S,14S,15S)-5,11,13-trihydroxy-2,15-dimethyl-14-tricyclo[8.7.0.02,7]heptadecanyl]-2H-furan-5-one (PubChem CID 129118366) has the molecular formula C23H36O5 and a molecular weight of 392.54 g/mol. Its IUPAC name is 3-[(1S,2S,5S,7R,10R,11S,13S,14S,15S)-5,11,13-trihydroxy-2,15-dimethyl-14-tricyclo[8.7.0.02,7]heptadecanyl]-2H-furan-5-one.
| Compound Name | 3-[(1S,2S,5S,7R,10R,11S,13S,14S,15S)-5,11,13-trihydroxy-2,15-dimethyl-14-tricyclo[8.7.0.02,7]heptadecanyl]-2H-furan-5-one |
|---|---|
| PubChem CID | 129118366 |
| Molecular Formula | C23H36O5 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.26 |
| IUPAC Name | 3-[(1S,2S,5S,7R,10R,11S,13S,14S,15S)-5,11,13-trihydroxy-2,15-dimethyl-14-tricyclo[8.7.0.02,7]heptadecanyl]-2H-furan-5-one |
| SMILES | C[C@H]1CC[C@H]2[C@@H](CC[C@@H]3C[C@@H](O)CC[C@@]32C)[C@@H](O)C[C@H](O)[C@@H]1C1=CC(=O)OC1 |
| InChI | InChI=1S/C23H36O5/c1-13-3-6-18-17(5-4-15-10-16(24)7-8-23(15,18)2)19(25)11-20(26)22(13)14-9-21(27)28-12-14/h9,13,15-20,22,24-26H,3-8,10-12H2,1-2H3/t13-,15+,16-,17+,18-,19-,20-,22-,23-/m0/s1 |
| InChIKey | LPCUMEBRHHFJQY-GQMJIEOKSA-N |
| XLogP | 2.82 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |