C15H25F3O4 — CID 129118460
[4-methyl-4-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)hexan-2-yl] 2-methylprop-2-enoate (PubChem CID 129118460) has the molecular formula C15H25F3O4 and a molecular weight of 326.36 g/mol. Its IUPAC name is [4-methyl-4-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)hexan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [4-methyl-4-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)hexan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129118460 |
| Molecular Formula | C15H25F3O4 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | [4-methyl-4-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)hexan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)CC(C)(CC)OCC(C)(O)C(F)(F)F |
| InChI | InChI=1S/C15H25F3O4/c1-7-13(5,8-11(4)22-12(19)10(2)3)21-9-14(6,20)15(16,17)18/h11,20H,2,7-9H2,1,3-6H3 |
| InChIKey | ZNYAGEHXAIIMMM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|