C19H31F3O4 — CID 129118465
[5-[2-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)propan-2-yl]cyclooctyl] 2-methylprop-2-enoate (PubChem CID 129118465) has the molecular formula C19H31F3O4 and a molecular weight of 380.45 g/mol. Its IUPAC name is [5-[2-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)propan-2-yl]cyclooctyl] 2-methylprop-2-enoate.
| Compound Name | [5-[2-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)propan-2-yl]cyclooctyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129118465 |
| Molecular Formula | C19H31F3O4 |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | [5-[2-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)propan-2-yl]cyclooctyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CCCC(C(C)(C)OCC(C)(O)C(F)(F)F)CCC1 |
| InChI | InChI=1S/C19H31F3O4/c1-13(2)16(23)26-15-10-6-8-14(9-7-11-15)17(3,4)25-12-18(5,24)19(20,21)22/h14-15,24H,1,6-12H2,2-5H3 |
| InChIKey | QPNKHSLHTRLHNW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|