C16H25F3O4 — CID 129118481
[2-[3-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)pentan-3-yl]cyclopropyl] 2-methylprop-2-enoate (PubChem CID 129118481) has the molecular formula C16H25F3O4 and a molecular weight of 338.37 g/mol. Its IUPAC name is [2-[3-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)pentan-3-yl]cyclopropyl] 2-methylprop-2-enoate.
| Compound Name | [2-[3-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)pentan-3-yl]cyclopropyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129118481 |
| Molecular Formula | C16H25F3O4 |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | [2-[3-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)pentan-3-yl]cyclopropyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1CC1C(CC)(CC)OCC(C)(O)C(F)(F)F |
| InChI | InChI=1S/C16H25F3O4/c1-6-15(7-2,22-9-14(5,21)16(17,18)19)11-8-12(11)23-13(20)10(3)4/h11-12,21H,3,6-9H2,1-2,4-5H3 |
| InChIKey | CCDNBMUHDBQSJP-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|