C35H57F3O8 — CID 129119031
[5-(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-2,5-dimethyl-2-(4,4,4-trifluoro-3-hydroxy-2,3-dimethylbutan-2-yl)oxyhexan-3-yl] 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate (PubChem CID 129119031) has the molecular formula C35H57F3O8 and a molecular weight of 662.83 g/mol. Its IUPAC name is [5-(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-2,5-dimethyl-2-(4,4,4-trifluoro-3-hydroxy-2,3-dimethylbutan-2-yl)oxyhexan-3-yl] 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate.
| Compound Name | [5-(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-2,5-dimethyl-2-(4,4,4-trifluoro-3-hydroxy-2,3-dimethylbutan-2-yl)oxyhexan-3-yl] 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate |
|---|---|
| PubChem CID | 129119031 |
| Molecular Formula | C35H57F3O8 |
| Molecular Weight | 662.83 g/mol |
| Exact Mass | 662.40 |
| IUPAC Name | [5-(3-hydroxy-2,3-dimethylbutan-2-yl)oxy-2,5-dimethyl-2-(4,4,4-trifluoro-3-hydroxy-2,3-dimethylbutan-2-yl)oxyhexan-3-yl] 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate |
| SMILES | C=C(C)C(=O)OC12CC3CC(C1)CC(C(=O)OC(CC(C)(C)OC(C)(C)C(C)(C)O)C(C)(C)OC(C)(C)C(C)(O)C(F)(F)F)(C3)C2 |
| InChI | InChI=1S/C35H57F3O8/c1-21(2)25(39)44-34-17-22-14-23(18-34)16-33(15-22,20-34)26(40)43-24(19-27(3,4)45-30(9,10)29(7,8)41)28(5,6)46-31(11,12)32(13,42)35(36,37)38/h22-24,41-42H,1,14-20H2,2-13H3 |
| InChIKey | USBDXYVCXAFUFP-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.83 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|