About (E)-1,2-dideuterio-N-propan-2-ylprop-1-ene-1-sulfonamide
(E)-1,2-dideuterio-N-propan-2-ylprop-1-ene-1-sulfonamide (PubChem CID 129119272) has the molecular formula C6H13NO2S
and a molecular weight of 165.25 g/mol. Its IUPAC name is (E)-1,2-dideuterio-N-propan-2-ylprop-1-ene-1-sulfonamide.
Molecular Properties
| Compound Name | (E)-1,2-dideuterio-N-propan-2-ylprop-1-ene-1-sulfonamide |
| PubChem CID | 129119272 |
| Molecular Formula | C6H13NO2S |
| Molecular Weight | 165.25 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | (E)-1,2-dideuterio-N-propan-2-ylprop-1-ene-1-sulfonamide |
| SMILES | [2H]/C(C)=C(/[2H])S(=O)(=O)NC(C)C |
| InChI | InChI=1S/C6H13NO2S/c1-4-5-10(8,9)7-6(2)3/h4-7H,1-3H3/b5-4+/i4D,5D |
| InChIKey | OKKQDMLYXYKAQO-AXXYTVHGSA-N |
| XLogP | 0.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.25 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (E)-1,2-dideuterio-N-propan-2-ylprop-1-ene-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,2-dideuterio-N-propan-2-ylprop-1-ene-1-sulfonamide?
The IUPAC name of (E)-1,2-dideuterio-N-propan-2-ylprop-1-ene-1-sulfonamide (CID 129119272) is (E)-1,2-dideuterio-N-propan-2-ylprop-1-ene-1-sulfonamide.
What is the SMILES notation for (E)-1,2-dideuterio-N-propan-2-ylprop-1-ene-1-sulfonamide?
The canonical SMILES for (E)-1,2-dideuterio-N-propan-2-ylprop-1-ene-1-sulfonamide is [2H]/C(C)=C(/[2H])S(=O)(=O)NC(C)C.
What is the InChIKey of (E)-1,2-dideuterio-N-propan-2-ylprop-1-ene-1-sulfonamide?
The InChIKey is OKKQDMLYXYKAQO-AXXYTVHGSA-N. The full InChI is InChI=1S/C6H13NO2S/c1-4-5-10(8,9)7-6(2)3/h4-7H,1-3H3/b5-4+/i4D,5D.
What are the key properties of (E)-1,2-dideuterio-N-propan-2-ylprop-1-ene-1-sulfonamide?
(E)-1,2-dideuterio-N-propan-2-ylprop-1-ene-1-sulfonamide has a molecular weight of 165.25 g/mol, XLogP of 0.85, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,2-dideuterio-N-propan-2-ylprop-1-ene-1-sulfonamide is sourced from PubChem (CID 129119272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).