About 1-O-[2-(dimethylamino)ethyl] 5-O-(2-hydroxyethyl) 4-(bromomethyl)-2,2,4-trimethylpentanedioate
1-O-[2-(dimethylamino)ethyl] 5-O-(2-hydroxyethyl) 4-(bromomethyl)-2,2,4-trimethylpentanedioate (PubChem CID 129119429) has the molecular formula C15H28BrNO5
and a molecular weight of 382.30 g/mol. Its IUPAC name is 1-O-[2-(dimethylamino)ethyl] 5-O-(2-hydroxyethyl) 4-(bromomethyl)-2,2,4-trimethylpentanedioate.
Molecular Properties
| Compound Name | 1-O-[2-(dimethylamino)ethyl] 5-O-(2-hydroxyethyl) 4-(bromomethyl)-2,2,4-trimethylpentanedioate |
| PubChem CID | 129119429 |
| Molecular Formula | C15H28BrNO5 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 1-O-[2-(dimethylamino)ethyl] 5-O-(2-hydroxyethyl) 4-(bromomethyl)-2,2,4-trimethylpentanedioate |
| SMILES | CN(C)CCOC(=O)C(C)(C)CC(C)(CBr)C(=O)OCCO |
| InChI | InChI=1S/C15H28BrNO5/c1-14(2,12(19)21-8-6-17(4)5)10-15(3,11-16)13(20)22-9-7-18/h18H,6-11H2,1-5H3 |
| InChIKey | JUXVAMSOJGLVCG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-O-[2-(dimethylamino)ethyl] 5-O-(2-hydroxyethyl) 4-(bromomethyl)-2,2,4-trimethylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-[2-(dimethylamino)ethyl] 5-O-(2-hydroxyethyl) 4-(bromomethyl)-2,2,4-trimethylpentanedioate?
The IUPAC name of 1-O-[2-(dimethylamino)ethyl] 5-O-(2-hydroxyethyl) 4-(bromomethyl)-2,2,4-trimethylpentanedioate (CID 129119429) is 1-O-[2-(dimethylamino)ethyl] 5-O-(2-hydroxyethyl) 4-(bromomethyl)-2,2,4-trimethylpentanedioate.
What is the SMILES notation for 1-O-[2-(dimethylamino)ethyl] 5-O-(2-hydroxyethyl) 4-(bromomethyl)-2,2,4-trimethylpentanedioate?
The canonical SMILES for 1-O-[2-(dimethylamino)ethyl] 5-O-(2-hydroxyethyl) 4-(bromomethyl)-2,2,4-trimethylpentanedioate is CN(C)CCOC(=O)C(C)(C)CC(C)(CBr)C(=O)OCCO.
What is the InChIKey of 1-O-[2-(dimethylamino)ethyl] 5-O-(2-hydroxyethyl) 4-(bromomethyl)-2,2,4-trimethylpentanedioate?
The InChIKey is JUXVAMSOJGLVCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28BrNO5/c1-14(2,12(19)21-8-6-17(4)5)10-15(3,11-16)13(20)22-9-7-18/h18H,6-11H2,1-5H3.
What are the key properties of 1-O-[2-(dimethylamino)ethyl] 5-O-(2-hydroxyethyl) 4-(bromomethyl)-2,2,4-trimethylpentanedioate?
1-O-[2-(dimethylamino)ethyl] 5-O-(2-hydroxyethyl) 4-(bromomethyl)-2,2,4-trimethylpentanedioate has a molecular weight of 382.30 g/mol, XLogP of 1.44, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-[2-(dimethylamino)ethyl] 5-O-(2-hydroxyethyl) 4-(bromomethyl)-2,2,4-trimethylpentanedioate is sourced from PubChem (CID 129119429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).