About N-ethylidene-N'-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]methanimidamide
N-ethylidene-N'-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]methanimidamide (PubChem CID 129119754) has the molecular formula C10H16N2
and a molecular weight of 164.25 g/mol. Its IUPAC name is N-ethylidene-N'-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]methanimidamide.
Molecular Properties
| Compound Name | N-ethylidene-N'-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]methanimidamide |
| PubChem CID | 129119754 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | N-ethylidene-N'-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]methanimidamide |
| SMILES | C=C/C(=C\N=C\N=C\C)C(C)C |
| InChI | InChI=1S/C10H16N2/c1-5-10(9(3)4)7-12-8-11-6-2/h5-9H,1H2,2-4H3/b10-7+,11-6+,12-8+ |
| InChIKey | CSSUXZYDUOYZKZ-PHIPYRSFSA-N |
| XLogP | 2.83 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-ethylidene-N'-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]methanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylidene-N'-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]methanimidamide?
The IUPAC name of N-ethylidene-N'-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]methanimidamide (CID 129119754) is N-ethylidene-N'-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]methanimidamide.
What is the SMILES notation for N-ethylidene-N'-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]methanimidamide?
The canonical SMILES for N-ethylidene-N'-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]methanimidamide is C=C/C(=C\N=C\N=C\C)C(C)C.
What is the InChIKey of N-ethylidene-N'-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]methanimidamide?
The InChIKey is CSSUXZYDUOYZKZ-PHIPYRSFSA-N. The full InChI is InChI=1S/C10H16N2/c1-5-10(9(3)4)7-12-8-11-6-2/h5-9H,1H2,2-4H3/b10-7+,11-6+,12-8+.
What are the key properties of N-ethylidene-N'-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]methanimidamide?
N-ethylidene-N'-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]methanimidamide has a molecular weight of 164.25 g/mol, XLogP of 2.83, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylidene-N'-[(1Z)-2-propan-2-ylbuta-1,3-dienyl]methanimidamide is sourced from PubChem (CID 129119754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).