C40H43FO2S — CID 129119958
7-fluoro-2,12-bis(3-methoxy-4-methyl-3-propan-2-ylpent-1-ynyl)-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene (PubChem CID 129119958) has the molecular formula C40H43FO2S and a molecular weight of 606.85 g/mol. Its IUPAC name is 7-fluoro-2,12-bis(3-methoxy-4-methyl-3-propan-2-ylpent-1-ynyl)-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene.
| Compound Name | 7-fluoro-2,12-bis(3-methoxy-4-methyl-3-propan-2-ylpent-1-ynyl)-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene |
|---|---|
| PubChem CID | 129119958 |
| Molecular Formula | C40H43FO2S |
| Molecular Weight | 606.85 g/mol |
| Exact Mass | 606.30 |
| IUPAC Name | 7-fluoro-2,12-bis(3-methoxy-4-methyl-3-propan-2-ylpent-1-ynyl)-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene |
| SMILES | COC(C#Cc1c2cc3ccccc3cc2c(C#CC(OC)(C(C)C)C(C)C)c2cc3sc(F)cc3cc12)(C(C)C)C(C)C |
| InChI | InChI=1S/C40H43FO2S/c1-24(2)39(42-9,25(3)4)17-15-31-33-19-28-13-11-12-14-29(28)20-34(33)32(16-18-40(43-10,26(5)6)27(7)8)36-23-37-30(21-35(31)36)22-38(41)44-37/h11-14,19-27H,1-10H3 |
| InChIKey | WSSAKAVFJWFNQG-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.85 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|