C39H34O2S2 — CID 129119968
2,12-bis(3-methoxy-3-methylbut-1-ynyl)-7-(4-methylphenyl)sulfanyl-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene (PubChem CID 129119968) has the molecular formula C39H34O2S2 and a molecular weight of 598.83 g/mol. Its IUPAC name is 2,12-bis(3-methoxy-3-methylbut-1-ynyl)-7-(4-methylphenyl)sulfanyl-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene.
| Compound Name | 2,12-bis(3-methoxy-3-methylbut-1-ynyl)-7-(4-methylphenyl)sulfanyl-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene |
|---|---|
| PubChem CID | 129119968 |
| Molecular Formula | C39H34O2S2 |
| Molecular Weight | 598.83 g/mol |
| Exact Mass | 598.20 |
| IUPAC Name | 2,12-bis(3-methoxy-3-methylbut-1-ynyl)-7-(4-methylphenyl)sulfanyl-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene |
| SMILES | COC(C)(C)C#Cc1c2cc3ccccc3cc2c(C#CC(C)(C)OC)c2cc3sc(Sc4ccc(C)cc4)cc3cc12 |
| InChI | InChI=1S/C39H34O2S2/c1-25-12-14-29(15-13-25)42-37-23-28-22-34-30(16-18-38(2,3)40-6)32-20-26-10-8-9-11-27(26)21-33(32)31(17-19-39(4,5)41-7)35(34)24-36(28)43-37/h8-15,20-24H,1-7H3 |
| InChIKey | KVEPPACDHVRDSH-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.83 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|