C34H31FO2S — CID 129120001
7-fluoro-2,12-bis(3-methoxy-3-methylbut-1-ynyl)-16,19-dimethyl-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene (PubChem CID 129120001) has the molecular formula C34H31FO2S and a molecular weight of 522.69 g/mol. Its IUPAC name is 7-fluoro-2,12-bis(3-methoxy-3-methylbut-1-ynyl)-16,19-dimethyl-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene.
| Compound Name | 7-fluoro-2,12-bis(3-methoxy-3-methylbut-1-ynyl)-16,19-dimethyl-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene |
|---|---|
| PubChem CID | 129120001 |
| Molecular Formula | C34H31FO2S |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | 7-fluoro-2,12-bis(3-methoxy-3-methylbut-1-ynyl)-16,19-dimethyl-6-thiapentacyclo[11.8.0.03,11.05,9.015,20]henicosa-1(21),2,4,7,9,11,13,15,17,19-decaene |
| SMILES | COC(C)(C)C#Cc1c2cc3cc(F)sc3cc2c(C#CC(C)(C)OC)c2cc3c(C)ccc(C)c3cc12 |
| InChI | InChI=1S/C34H31FO2S/c1-20-9-10-21(2)26-18-29-24(12-14-34(5,6)37-8)30-19-31-22(16-32(35)38-31)15-27(30)23(28(29)17-25(20)26)11-13-33(3,4)36-7/h9-10,15-19H,1-8H3 |
| InChIKey | UPZIUUXFXQUTOK-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|