About (3S)-2,2-dimethyl-3-[[2-(prop-2-enoylamino)acetyl]amino]butanoic acid
(3S)-2,2-dimethyl-3-[[2-(prop-2-enoylamino)acetyl]amino]butanoic acid (PubChem CID 129120104) has the molecular formula C11H18N2O4
and a molecular weight of 242.27 g/mol. Its IUPAC name is (3S)-2,2-dimethyl-3-[[2-(prop-2-enoylamino)acetyl]amino]butanoic acid.
Molecular Properties
| Compound Name | (3S)-2,2-dimethyl-3-[[2-(prop-2-enoylamino)acetyl]amino]butanoic acid |
| PubChem CID | 129120104 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (3S)-2,2-dimethyl-3-[[2-(prop-2-enoylamino)acetyl]amino]butanoic acid |
| SMILES | C=CC(=O)NCC(=O)N[C@@H](C)C(C)(C)C(=O)O |
| InChI | InChI=1S/C11H18N2O4/c1-5-8(14)12-6-9(15)13-7(2)11(3,4)10(16)17/h5,7H,1,6H2,2-4H3,(H,12,14)(H,13,15)(H,16,17)/t7-/m0/s1 |
| InChIKey | SXTLBKHASPWYFA-ZETCQYMHSA-N |
| XLogP | -0.10 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3S)-2,2-dimethyl-3-[[2-(prop-2-enoylamino)acetyl]amino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-2,2-dimethyl-3-[[2-(prop-2-enoylamino)acetyl]amino]butanoic acid?
The IUPAC name of (3S)-2,2-dimethyl-3-[[2-(prop-2-enoylamino)acetyl]amino]butanoic acid (CID 129120104) is (3S)-2,2-dimethyl-3-[[2-(prop-2-enoylamino)acetyl]amino]butanoic acid.
What is the SMILES notation for (3S)-2,2-dimethyl-3-[[2-(prop-2-enoylamino)acetyl]amino]butanoic acid?
The canonical SMILES for (3S)-2,2-dimethyl-3-[[2-(prop-2-enoylamino)acetyl]amino]butanoic acid is C=CC(=O)NCC(=O)N[C@@H](C)C(C)(C)C(=O)O.
What is the InChIKey of (3S)-2,2-dimethyl-3-[[2-(prop-2-enoylamino)acetyl]amino]butanoic acid?
The InChIKey is SXTLBKHASPWYFA-ZETCQYMHSA-N. The full InChI is InChI=1S/C11H18N2O4/c1-5-8(14)12-6-9(15)13-7(2)11(3,4)10(16)17/h5,7H,1,6H2,2-4H3,(H,12,14)(H,13,15)(H,16,17)/t7-/m0/s1.
What are the key properties of (3S)-2,2-dimethyl-3-[[2-(prop-2-enoylamino)acetyl]amino]butanoic acid?
(3S)-2,2-dimethyl-3-[[2-(prop-2-enoylamino)acetyl]amino]butanoic acid has a molecular weight of 242.27 g/mol, XLogP of -0.10, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-2,2-dimethyl-3-[[2-(prop-2-enoylamino)acetyl]amino]butanoic acid is sourced from PubChem (CID 129120104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).