C27H43NO5S — CID 129120456
(4S,7S,8R,9S,13Z,16S)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[2-methyl-1-(2-methyl-1,3-thiazol-4-yl)propan-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione (PubChem CID 129120456) has the molecular formula C27H43NO5S and a molecular weight of 493.71 g/mol. Its IUPAC name is (4S,7S,8R,9S,13Z,16S)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[2-methyl-1-(2-methyl-1,3-thiazol-4-yl)propan-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione.
| Compound Name | (4S,7S,8R,9S,13Z,16S)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[2-methyl-1-(2-methyl-1,3-thiazol-4-yl)propan-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione |
|---|---|
| PubChem CID | 129120456 |
| Molecular Formula | C27H43NO5S |
| Molecular Weight | 493.71 g/mol |
| Exact Mass | 493.29 |
| IUPAC Name | (4S,7S,8R,9S,13Z,16S)-4,8-dihydroxy-5,5,7,9-tetramethyl-16-[2-methyl-1-(2-methyl-1,3-thiazol-4-yl)propan-2-yl]-1-oxacyclohexadec-13-ene-2,6-dione |
| SMILES | Cc1nc(CC(C)(C)[C@@H]2C/C=C\CCC[C@H](C)[C@@H](O)[C@H](C)C(=O)C(C)(C)[C@@H](O)CC(=O)O2)cs1 |
| InChI | InChI=1S/C27H43NO5S/c1-17-12-10-8-9-11-13-22(26(4,5)15-20-16-34-19(3)28-20)33-23(30)14-21(29)27(6,7)25(32)18(2)24(17)31/h9,11,16-18,21-22,24,29,31H,8,10,12-15H2,1-7H3/b11-9-/t17-,18-,21-,22-,24+/m0/s1 |
| InChIKey | YLCGVANSEGMCDM-IXIGDRCWSA-N |
| XLogP | 5.04 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.71 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|