C24H34N4O4 — CID 129120567
4-[(1Z,3E)-1-(methylideneamino)-4-[[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]methoxy]penta-1,3-dienyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 129120567) has the molecular formula C24H34N4O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is 4-[(1Z,3E)-1-(methylideneamino)-4-[[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]methoxy]penta-1,3-dienyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 4-[(1Z,3E)-1-(methylideneamino)-4-[[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]methoxy]penta-1,3-dienyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 129120567 |
| Molecular Formula | C24H34N4O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 4-[(1Z,3E)-1-(methylideneamino)-4-[[1-(3-propan-2-yl-1,2,4-oxadiazol-5-yl)piperidin-4-yl]methoxy]penta-1,3-dienyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | C=N/C(=C\C=C(/C)OCC1CCN(c2nc(C(C)C)no2)CC1)C1=CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C24H34N4O4/c1-16(2)22-26-24(32-27-22)28-13-11-18(12-14-28)15-31-17(3)5-10-21(25-4)19-6-8-20(9-7-19)23(29)30/h5-6,10,16,18,20H,4,7-9,11-15H2,1-3H3,(H,29,30)/b17-5+,21-10- |
| InChIKey | CBLRDXASEVGNJH-MKJVOTPLSA-N |
| XLogP | 4.73 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|