About N-[(1E)-2-bromobuta-1,3-dienyl]-N,N'-bis(ethenyl)prop-2-enimidamide
N-[(1E)-2-bromobuta-1,3-dienyl]-N,N'-bis(ethenyl)prop-2-enimidamide (PubChem CID 129120834) has the molecular formula C11H13BrN2
and a molecular weight of 253.14 g/mol. Its IUPAC name is N-[(1E)-2-bromobuta-1,3-dienyl]-N,N'-bis(ethenyl)prop-2-enimidamide.
Molecular Properties
| Compound Name | N-[(1E)-2-bromobuta-1,3-dienyl]-N,N'-bis(ethenyl)prop-2-enimidamide |
| PubChem CID | 129120834 |
| Molecular Formula | C11H13BrN2 |
| Molecular Weight | 253.14 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | N-[(1E)-2-bromobuta-1,3-dienyl]-N,N'-bis(ethenyl)prop-2-enimidamide |
| SMILES | C=C/N=C(\C=C)N(C=C)/C=C(/Br)C=C |
| InChI | InChI=1S/C11H13BrN2/c1-5-10(12)9-14(8-4)11(6-2)13-7-3/h5-9H,1-4H2/b10-9+,13-11+ |
| InChIKey | CXIAIIIHCVFJPL-SNMPHBPQSA-N |
| XLogP | 3.58 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.14 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1E)-2-bromobuta-1,3-dienyl]-N,N'-bis(ethenyl)prop-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1E)-2-bromobuta-1,3-dienyl]-N,N'-bis(ethenyl)prop-2-enimidamide?
The IUPAC name of N-[(1E)-2-bromobuta-1,3-dienyl]-N,N'-bis(ethenyl)prop-2-enimidamide (CID 129120834) is N-[(1E)-2-bromobuta-1,3-dienyl]-N,N'-bis(ethenyl)prop-2-enimidamide.
What is the SMILES notation for N-[(1E)-2-bromobuta-1,3-dienyl]-N,N'-bis(ethenyl)prop-2-enimidamide?
The canonical SMILES for N-[(1E)-2-bromobuta-1,3-dienyl]-N,N'-bis(ethenyl)prop-2-enimidamide is C=C/N=C(\C=C)N(C=C)/C=C(/Br)C=C.
What is the InChIKey of N-[(1E)-2-bromobuta-1,3-dienyl]-N,N'-bis(ethenyl)prop-2-enimidamide?
The InChIKey is CXIAIIIHCVFJPL-SNMPHBPQSA-N. The full InChI is InChI=1S/C11H13BrN2/c1-5-10(12)9-14(8-4)11(6-2)13-7-3/h5-9H,1-4H2/b10-9+,13-11+.
What are the key properties of N-[(1E)-2-bromobuta-1,3-dienyl]-N,N'-bis(ethenyl)prop-2-enimidamide?
N-[(1E)-2-bromobuta-1,3-dienyl]-N,N'-bis(ethenyl)prop-2-enimidamide has a molecular weight of 253.14 g/mol, XLogP of 3.58, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1E)-2-bromobuta-1,3-dienyl]-N,N'-bis(ethenyl)prop-2-enimidamide is sourced from PubChem (CID 129120834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).