C31H29FN6O — CID 129120909
(11R,16S)-5-anilino-4-[[4-(4-fluorophenyl)phenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,9-trien-7-one (PubChem CID 129120909) has the molecular formula C31H29FN6O and a molecular weight of 520.61 g/mol. Its IUPAC name is (11R,16S)-5-anilino-4-[[4-(4-fluorophenyl)phenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,9-trien-7-one.
| Compound Name | (11R,16S)-5-anilino-4-[[4-(4-fluorophenyl)phenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 129120909 |
| Molecular Formula | C31H29FN6O |
| Molecular Weight | 520.61 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | (11R,16S)-5-anilino-4-[[4-(4-fluorophenyl)phenyl]methyl]-8-methyl-1,3,4,8,10-pentazatetracyclo[7.7.0.02,6.011,16]hexadeca-2,5,9-trien-7-one |
| SMILES | CN1C(=O)c2c(nn(Cc3ccc(-c4ccc(F)cc4)cc3)c2Nc2ccccc2)N2C1=N[C@@H]1CCCC[C@@H]12 |
| InChI | InChI=1S/C31H29FN6O/c1-36-30(39)27-28(33-24-7-3-2-4-8-24)37(35-29(27)38-26-10-6-5-9-25(26)34-31(36)38)19-20-11-13-21(14-12-20)22-15-17-23(32)18-16-22/h2-4,7-8,11-18,25-26,33H,5-6,9-10,19H2,1H3/t25-,26+/m1/s1 |
| InChIKey | OVVYVDRBJCITSO-FTJBHMTQSA-N |
| XLogP | 6.05 |
| TPSA | 65.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.61 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |