C29H26FN7O3 — CID 129120967
(11R,15S)-4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-5-(4-hydroxyanilino)-8-methyl-10-oxido-1,3,4,8-tetraza-10-azoniatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one (PubChem CID 129120967) has the molecular formula C29H26FN7O3 and a molecular weight of 539.57 g/mol. Its IUPAC name is (11R,15S)-4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-5-(4-hydroxyanilino)-8-methyl-10-oxido-1,3,4,8-tetraza-10-azoniatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one.
| Compound Name | (11R,15S)-4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-5-(4-hydroxyanilino)-8-methyl-10-oxido-1,3,4,8-tetraza-10-azoniatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
|---|---|
| PubChem CID | 129120967 |
| Molecular Formula | C29H26FN7O3 |
| Molecular Weight | 539.57 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | (11R,15S)-4-[[4-(6-fluoro-2-pyridinyl)phenyl]methyl]-5-(4-hydroxyanilino)-8-methyl-10-oxido-1,3,4,8-tetraza-10-azoniatetracyclo[7.6.0.02,6.011,15]pentadeca-2,5,9-trien-7-one |
| SMILES | CN1C(=O)c2c(nn(Cc3ccc(-c4cccc(F)n4)cc3)c2Nc2ccc(O)cc2)N2C1=[N+]([O-])[C@@H]1CCC[C@@H]12 |
| InChI | InChI=1S/C29H26FN7O3/c1-34-28(39)25-26(31-19-12-14-20(38)15-13-19)35(33-27(25)36-22-5-3-6-23(22)37(40)29(34)36)16-17-8-10-18(11-9-17)21-4-2-7-24(30)32-21/h2,4,7-15,22-23,31,38H,3,5-6,16H2,1H3/t22-,23+/m0/s1 |
| InChIKey | IKNTVXVXPZJPCO-XZOQPEGZSA-N |
| XLogP | 4.27 |
| TPSA | 112.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.57 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|