C18H22BrN3O — CID 129121268
8-bromo-1-(3-methoxycyclohexyl)-3-methyl-2H-imidazo[4,5-c]quinoline (PubChem CID 129121268) has the molecular formula C18H22BrN3O and a molecular weight of 376.30 g/mol. Its IUPAC name is 8-bromo-1-(3-methoxycyclohexyl)-3-methyl-2H-imidazo[4,5-c]quinoline.
| Compound Name | 8-bromo-1-(3-methoxycyclohexyl)-3-methyl-2H-imidazo[4,5-c]quinoline |
|---|---|
| PubChem CID | 129121268 |
| Molecular Formula | C18H22BrN3O |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 8-bromo-1-(3-methoxycyclohexyl)-3-methyl-2H-imidazo[4,5-c]quinoline |
| SMILES | COC1CCCC(N2CN(C)c3cnc4ccc(Br)cc4c32)C1 |
| InChI | InChI=1S/C18H22BrN3O/c1-21-11-22(13-4-3-5-14(9-13)23-2)18-15-8-12(19)6-7-16(15)20-10-17(18)21/h6-8,10,13-14H,3-5,9,11H2,1-2H3 |
| InChIKey | DADRNTOCARHDGD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |