About 1,2-bis(1-hydroxycyclopentyl)ethyl 2-iodobutanoate
1,2-bis(1-hydroxycyclopentyl)ethyl 2-iodobutanoate (PubChem CID 129121555) has the molecular formula C16H27IO4
and a molecular weight of 410.29 g/mol. Its IUPAC name is 1,2-bis(1-hydroxycyclopentyl)ethyl 2-iodobutanoate.
Molecular Properties
| Compound Name | 1,2-bis(1-hydroxycyclopentyl)ethyl 2-iodobutanoate |
| PubChem CID | 129121555 |
| Molecular Formula | C16H27IO4 |
| Molecular Weight | 410.29 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | 1,2-bis(1-hydroxycyclopentyl)ethyl 2-iodobutanoate |
| SMILES | CCC(I)C(=O)OC(CC1(O)CCCC1)C1(O)CCCC1 |
| InChI | InChI=1S/C16H27IO4/c1-2-12(17)14(18)21-13(16(20)9-5-6-10-16)11-15(19)7-3-4-8-15/h12-13,19-20H,2-11H2,1H3 |
| InChIKey | IUCQXLOFJNVCJP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.29 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1,2-bis(1-hydroxycyclopentyl)ethyl 2-iodobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-bis(1-hydroxycyclopentyl)ethyl 2-iodobutanoate?
The IUPAC name of 1,2-bis(1-hydroxycyclopentyl)ethyl 2-iodobutanoate (CID 129121555) is 1,2-bis(1-hydroxycyclopentyl)ethyl 2-iodobutanoate.
What is the SMILES notation for 1,2-bis(1-hydroxycyclopentyl)ethyl 2-iodobutanoate?
The canonical SMILES for 1,2-bis(1-hydroxycyclopentyl)ethyl 2-iodobutanoate is CCC(I)C(=O)OC(CC1(O)CCCC1)C1(O)CCCC1.
What is the InChIKey of 1,2-bis(1-hydroxycyclopentyl)ethyl 2-iodobutanoate?
The InChIKey is IUCQXLOFJNVCJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27IO4/c1-2-12(17)14(18)21-13(16(20)9-5-6-10-16)11-15(19)7-3-4-8-15/h12-13,19-20H,2-11H2,1H3.
What are the key properties of 1,2-bis(1-hydroxycyclopentyl)ethyl 2-iodobutanoate?
1,2-bis(1-hydroxycyclopentyl)ethyl 2-iodobutanoate has a molecular weight of 410.29 g/mol, XLogP of 3.11, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-bis(1-hydroxycyclopentyl)ethyl 2-iodobutanoate is sourced from PubChem (CID 129121555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).