C21H33IO8 — CID 129121855
(2,5-dihydroxy-2,5-dimethylhexan-3-yl) 4-(2-iodo-2-methylbutanoyl)oxy-7-oxo-6-oxabicyclo[3.2.1]octane-2-carboxylate (PubChem CID 129121855) has the molecular formula C21H33IO8 and a molecular weight of 540.39 g/mol. Its IUPAC name is (2,5-dihydroxy-2,5-dimethylhexan-3-yl) 4-(2-iodo-2-methylbutanoyl)oxy-7-oxo-6-oxabicyclo[3.2.1]octane-2-carboxylate.
| Compound Name | (2,5-dihydroxy-2,5-dimethylhexan-3-yl) 4-(2-iodo-2-methylbutanoyl)oxy-7-oxo-6-oxabicyclo[3.2.1]octane-2-carboxylate |
|---|---|
| PubChem CID | 129121855 |
| Molecular Formula | C21H33IO8 |
| Molecular Weight | 540.39 g/mol |
| Exact Mass | 540.12 |
| IUPAC Name | (2,5-dihydroxy-2,5-dimethylhexan-3-yl) 4-(2-iodo-2-methylbutanoyl)oxy-7-oxo-6-oxabicyclo[3.2.1]octane-2-carboxylate |
| SMILES | CCC(C)(I)C(=O)OC1CC(C(=O)OC(CC(C)(C)O)C(C)(C)O)C2CC1OC2=O |
| InChI | InChI=1S/C21H33IO8/c1-7-21(6,22)18(25)29-14-9-12(11-8-13(14)28-16(11)23)17(24)30-15(20(4,5)27)10-19(2,3)26/h11-15,26-27H,7-10H2,1-6H3 |
| InChIKey | DRDZDUFRFMVCNT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.39 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|