About 7-methyl-4-(4-nitrophenyl)-3-phenyl-1,2-dihydronaphthalene
7-methyl-4-(4-nitrophenyl)-3-phenyl-1,2-dihydronaphthalene (PubChem CID 129122010) has the molecular formula C23H19NO2
and a molecular weight of 341.41 g/mol. Its IUPAC name is 7-methyl-4-(4-nitrophenyl)-3-phenyl-1,2-dihydronaphthalene.
Molecular Properties
| Compound Name | 7-methyl-4-(4-nitrophenyl)-3-phenyl-1,2-dihydronaphthalene |
| PubChem CID | 129122010 |
| Molecular Formula | C23H19NO2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 7-methyl-4-(4-nitrophenyl)-3-phenyl-1,2-dihydronaphthalene |
| SMILES | Cc1ccc2c(c1)CCC(c1ccccc1)=C2c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H19NO2/c1-16-7-13-22-19(15-16)10-14-21(17-5-3-2-4-6-17)23(22)18-8-11-20(12-9-18)24(25)26/h2-9,11-13,15H,10,14H2,1H3 |
| InChIKey | KGXIAJRJOXSFOS-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 7-methyl-4-(4-nitrophenyl)-3-phenyl-1,2-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-4-(4-nitrophenyl)-3-phenyl-1,2-dihydronaphthalene?
The IUPAC name of 7-methyl-4-(4-nitrophenyl)-3-phenyl-1,2-dihydronaphthalene (CID 129122010) is 7-methyl-4-(4-nitrophenyl)-3-phenyl-1,2-dihydronaphthalene.
What is the SMILES notation for 7-methyl-4-(4-nitrophenyl)-3-phenyl-1,2-dihydronaphthalene?
The canonical SMILES for 7-methyl-4-(4-nitrophenyl)-3-phenyl-1,2-dihydronaphthalene is Cc1ccc2c(c1)CCC(c1ccccc1)=C2c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 7-methyl-4-(4-nitrophenyl)-3-phenyl-1,2-dihydronaphthalene?
The InChIKey is KGXIAJRJOXSFOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19NO2/c1-16-7-13-22-19(15-16)10-14-21(17-5-3-2-4-6-17)23(22)18-8-11-20(12-9-18)24(25)26/h2-9,11-13,15H,10,14H2,1H3.
What are the key properties of 7-methyl-4-(4-nitrophenyl)-3-phenyl-1,2-dihydronaphthalene?
7-methyl-4-(4-nitrophenyl)-3-phenyl-1,2-dihydronaphthalene has a molecular weight of 341.41 g/mol, XLogP of 5.81, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-4-(4-nitrophenyl)-3-phenyl-1,2-dihydronaphthalene is sourced from PubChem (CID 129122010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).