C38H22N6S — CID 129123648
14-[3-(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)phenyl]-3-thia-15-azapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16,18,20-decaene (PubChem CID 129123648) has the molecular formula C38H22N6S and a molecular weight of 594.70 g/mol. Its IUPAC name is 14-[3-(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)phenyl]-3-thia-15-azapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16,18,20-decaene.
| Compound Name | 14-[3-(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)phenyl]-3-thia-15-azapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16,18,20-decaene |
|---|---|
| PubChem CID | 129123648 |
| Molecular Formula | C38H22N6S |
| Molecular Weight | 594.70 g/mol |
| Exact Mass | 594.16 |
| IUPAC Name | 14-[3-(4,6-dipyridin-4-yl-1,3,5-triazin-2-yl)phenyl]-3-thia-15-azapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16,18,20-decaene |
| SMILES | c1cc(-c2nc(-c3ccncc3)nc(-c3ccncc3)n2)cc(-c2nc3ccccc3c3c2ccc2c4ccccc4sc23)c1 |
| InChI | InChI=1S/C38H22N6S/c1-3-10-31-29(9-1)33-30(13-12-28-27-8-2-4-11-32(27)45-35(28)33)34(41-31)25-6-5-7-26(22-25)38-43-36(23-14-18-39-19-15-23)42-37(44-38)24-16-20-40-21-17-24/h1-22H |
| InChIKey | MPVBCXKJMRXSBS-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.70 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|