C44H26N6O — CID 129123662
14-[3-[4-(4,6-dipyridin-3-yl-1,3,5-triazin-2-yl)phenyl]phenyl]-3-oxa-15-azapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16,18,20-decaene (PubChem CID 129123662) has the molecular formula C44H26N6O and a molecular weight of 654.73 g/mol. Its IUPAC name is 14-[3-[4-(4,6-dipyridin-3-yl-1,3,5-triazin-2-yl)phenyl]phenyl]-3-oxa-15-azapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16,18,20-decaene.
| Compound Name | 14-[3-[4-(4,6-dipyridin-3-yl-1,3,5-triazin-2-yl)phenyl]phenyl]-3-oxa-15-azapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16,18,20-decaene |
|---|---|
| PubChem CID | 129123662 |
| Molecular Formula | C44H26N6O |
| Molecular Weight | 654.73 g/mol |
| Exact Mass | 654.22 |
| IUPAC Name | 14-[3-[4-(4,6-dipyridin-3-yl-1,3,5-triazin-2-yl)phenyl]phenyl]-3-oxa-15-azapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16,18,20-decaene |
| SMILES | c1cncc(-c2nc(-c3ccc(-c4cccc(-c5nc6ccccc6c6c5ccc5c7ccccc7oc56)c4)cc3)nc(-c3cccnc3)n2)c1 |
| InChI | InChI=1S/C44H26N6O/c1-3-14-37-35(13-1)39-36(21-20-34-33-12-2-4-15-38(33)51-41(34)39)40(47-37)30-9-5-8-29(24-30)27-16-18-28(19-17-27)42-48-43(31-10-6-22-45-25-31)50-44(49-42)32-11-7-23-46-26-32/h1-26H |
| InChIKey | VIYAATHMVKTKPH-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 90.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.73 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|