C55H40N2S — CID 129124364
N-(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-N-[4-(3-thia-15-azapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16,18,20-decaen-14-yl)phenyl]fluoren-2-amine (PubChem CID 129124364) has the molecular formula C55H40N2S and a molecular weight of 761.00 g/mol. Its IUPAC name is N-(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-N-[4-(3-thia-15-azapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16,18,20-decaen-14-yl)phenyl]fluoren-2-amine.
| Compound Name | N-(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-N-[4-(3-thia-15-azapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16,18,20-decaen-14-yl)phenyl]fluoren-2-amine |
|---|---|
| PubChem CID | 129124364 |
| Molecular Formula | C55H40N2S |
| Molecular Weight | 761.00 g/mol |
| Exact Mass | 760.29 |
| IUPAC Name | N-(9,9-dimethylfluoren-2-yl)-9,9-dimethyl-N-[4-(3-thia-15-azapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(13),2(10),4,6,8,11,14,16,18,20-decaen-14-yl)phenyl]fluoren-2-amine |
| SMILES | CC1(C2=CC=CC=C2C3=C1C=C(C=C3)N(C4=CC=C(C=C4)C5=NC6=CC=CC=C6C7=C5C=CC8=C7SC9=CC=CC=C89)C1=CC2=C(C=C1)C1=CC=CC=C1C2(C)C)C |
| InChI | InChI=1S/C55H40N2S/c1-54(2)45-17-9-5-13-37(45)39-27-25-35(31-47(39)54)57(36-26-28-40-38-14-6-10-18-46(38)55(3,4)48(40)32-36)34-23-21-33(22-24-34)52-44-30-29-42-41-15-8-12-20-50(41)58-53(42)51(44)43-16-7-11-19-49(43)56-52/h5-32H,1-4H3 |
| InChIKey | ZSNRDNNBWYUWHG-UHFFFAOYSA-N |
| XLogP | 15.70 |
| TPSA | 44.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | 1400 |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.00 |
| LogP ≤ 5 | 15.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|