C20H37N3O3 — CID 129124758
tert-butyl 4-[2-(1-ethylpiperidin-4-yl)ethylcarbamoyl]piperidine-1-carboxylate (PubChem CID 129124758) has the molecular formula C20H37N3O3 and a molecular weight of 367.53 g/mol. Its IUPAC name is tert-butyl 4-[2-(1-ethylpiperidin-4-yl)ethylcarbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(1-ethylpiperidin-4-yl)ethylcarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 129124758 |
| Molecular Formula | C20H37N3O3 |
| Molecular Weight | 367.53 g/mol |
| Exact Mass | 367.28 |
| IUPAC Name | tert-butyl 4-[2-(1-ethylpiperidin-4-yl)ethylcarbamoyl]piperidine-1-carboxylate |
| SMILES | CCN1CCC(CCNC(=O)C2CCN(C(=O)OC(C)(C)C)CC2)CC1 |
| InChI | InChI=1S/C20H37N3O3/c1-5-22-12-7-16(8-13-22)6-11-21-18(24)17-9-14-23(15-10-17)19(25)26-20(2,3)4/h16-17H,5-15H2,1-4H3,(H,21,24) |
| InChIKey | RLZCGLQMJJEECY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |