About 1-imino-4-(2-iodopropan-2-yl)-1,4-thiazinane 1-oxide
1-imino-4-(2-iodopropan-2-yl)-1,4-thiazinane 1-oxide (PubChem CID 129125187) has the molecular formula C7H15IN2OS
and a molecular weight of 302.18 g/mol. Its IUPAC name is 1-imino-4-(2-iodopropan-2-yl)-1,4-thiazinane 1-oxide.
Molecular Properties
| Compound Name | 1-imino-4-(2-iodopropan-2-yl)-1,4-thiazinane 1-oxide |
| PubChem CID | 129125187 |
| Molecular Formula | C7H15IN2OS |
| Molecular Weight | 302.18 g/mol |
| Exact Mass | 301.99 |
| IUPAC Name | 1-imino-4-(2-iodopropan-2-yl)-1,4-thiazinane 1-oxide |
| SMILES | [H]N=S1(=O)CCN(C(C)(C)I)CC1 |
| InChI | InChI=1S/C7H15IN2OS/c1-7(2,8)10-3-5-12(9,11)6-4-10/h9H,3-6H2,1-2H3 |
| InChIKey | WCFAACXTNKYGJL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 44.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.18 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-imino-4-(2-iodopropan-2-yl)-1,4-thiazinane 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-imino-4-(2-iodopropan-2-yl)-1,4-thiazinane 1-oxide?
The IUPAC name of 1-imino-4-(2-iodopropan-2-yl)-1,4-thiazinane 1-oxide (CID 129125187) is 1-imino-4-(2-iodopropan-2-yl)-1,4-thiazinane 1-oxide.
What is the SMILES notation for 1-imino-4-(2-iodopropan-2-yl)-1,4-thiazinane 1-oxide?
The canonical SMILES for 1-imino-4-(2-iodopropan-2-yl)-1,4-thiazinane 1-oxide is [H]N=S1(=O)CCN(C(C)(C)I)CC1.
What is the InChIKey of 1-imino-4-(2-iodopropan-2-yl)-1,4-thiazinane 1-oxide?
The InChIKey is WCFAACXTNKYGJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15IN2OS/c1-7(2,8)10-3-5-12(9,11)6-4-10/h9H,3-6H2,1-2H3.
What are the key properties of 1-imino-4-(2-iodopropan-2-yl)-1,4-thiazinane 1-oxide?
1-imino-4-(2-iodopropan-2-yl)-1,4-thiazinane 1-oxide has a molecular weight of 302.18 g/mol, XLogP of 1.52, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-imino-4-(2-iodopropan-2-yl)-1,4-thiazinane 1-oxide is sourced from PubChem (CID 129125187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).