C26H23F2N7O — CID 129125242
4-[4-(1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridin-5-yl)-5-fluoro-1-(2-methylindazol-5-yl)-6-oxopyrimidin-2-yl]-2-fluorobenzonitrile (PubChem CID 129125242) has the molecular formula C26H23F2N7O and a molecular weight of 487.51 g/mol. Its IUPAC name is 4-[4-(1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridin-5-yl)-5-fluoro-1-(2-methylindazol-5-yl)-6-oxopyrimidin-2-yl]-2-fluorobenzonitrile.
| Compound Name | 4-[4-(1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridin-5-yl)-5-fluoro-1-(2-methylindazol-5-yl)-6-oxopyrimidin-2-yl]-2-fluorobenzonitrile |
|---|---|
| PubChem CID | 129125242 |
| Molecular Formula | C26H23F2N7O |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 4-[4-(1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,4-c]pyridin-5-yl)-5-fluoro-1-(2-methylindazol-5-yl)-6-oxopyrimidin-2-yl]-2-fluorobenzonitrile |
| SMILES | Cn1cc2cc(-n3c(-c4ccc(C#N)c(F)c4)nc(N4CCC5CNCC5C4)c(F)c3=O)ccc2n1 |
| InChI | InChI=1S/C26H23F2N7O/c1-33-13-18-8-20(4-5-22(18)32-33)35-24(15-2-3-16(10-29)21(27)9-15)31-25(23(28)26(35)36)34-7-6-17-11-30-12-19(17)14-34/h2-5,8-9,13,17,19,30H,6-7,11-12,14H2,1H3 |
| InChIKey | ZBEACGUGSSQJDK-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 91.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |