About 1-cyclohexa-1,3-dien-1-yl-4-methyl-1,4-diazepane
1-cyclohexa-1,3-dien-1-yl-4-methyl-1,4-diazepane (PubChem CID 129125449) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is 1-cyclohexa-1,3-dien-1-yl-4-methyl-1,4-diazepane.
Molecular Properties
| Compound Name | 1-cyclohexa-1,3-dien-1-yl-4-methyl-1,4-diazepane |
| PubChem CID | 129125449 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 1-cyclohexa-1,3-dien-1-yl-4-methyl-1,4-diazepane |
| SMILES | CN1CCCN(C2=CC=CCC2)CC1 |
| InChI | InChI=1S/C12H20N2/c1-13-8-5-9-14(11-10-13)12-6-3-2-4-7-12/h2-3,6H,4-5,7-11H2,1H3 |
| InChIKey | JNZCQPFGIOJKSZ-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclohexa-1,3-dien-1-yl-4-methyl-1,4-diazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexa-1,3-dien-1-yl-4-methyl-1,4-diazepane?
The IUPAC name of 1-cyclohexa-1,3-dien-1-yl-4-methyl-1,4-diazepane (CID 129125449) is 1-cyclohexa-1,3-dien-1-yl-4-methyl-1,4-diazepane.
What is the SMILES notation for 1-cyclohexa-1,3-dien-1-yl-4-methyl-1,4-diazepane?
The canonical SMILES for 1-cyclohexa-1,3-dien-1-yl-4-methyl-1,4-diazepane is CN1CCCN(C2=CC=CCC2)CC1.
What is the InChIKey of 1-cyclohexa-1,3-dien-1-yl-4-methyl-1,4-diazepane?
The InChIKey is JNZCQPFGIOJKSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2/c1-13-8-5-9-14(11-10-13)12-6-3-2-4-7-12/h2-3,6H,4-5,7-11H2,1H3.
What are the key properties of 1-cyclohexa-1,3-dien-1-yl-4-methyl-1,4-diazepane?
1-cyclohexa-1,3-dien-1-yl-4-methyl-1,4-diazepane has a molecular weight of 192.31 g/mol, XLogP of 1.86, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexa-1,3-dien-1-yl-4-methyl-1,4-diazepane is sourced from PubChem (CID 129125449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).