C28H28F2I2NO2PS — CID 129126363
[(5R,6S)-5-[4-[2-[3-(difluoromethyl)azetidin-1-yl]ethoxy]phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-yl]oxysulfanyl-diiodophosphane (PubChem CID 129126363) has the molecular formula C28H28F2I2NO2PS and a molecular weight of 765.38 g/mol. Its IUPAC name is [(5R,6S)-5-[4-[2-[3-(difluoromethyl)azetidin-1-yl]ethoxy]phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-yl]oxysulfanyl-diiodophosphane.
| Compound Name | [(5R,6S)-5-[4-[2-[3-(difluoromethyl)azetidin-1-yl]ethoxy]phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-yl]oxysulfanyl-diiodophosphane |
|---|---|
| PubChem CID | 129126363 |
| Molecular Formula | C28H28F2I2NO2PS |
| Molecular Weight | 765.38 g/mol |
| Exact Mass | 764.96 |
| IUPAC Name | [(5R,6S)-5-[4-[2-[3-(difluoromethyl)azetidin-1-yl]ethoxy]phenyl]-6-phenyl-5,6,7,8-tetrahydronaphthalen-2-yl]oxysulfanyl-diiodophosphane |
| SMILES | FC(F)C1CN(CCOc2ccc([C@@H]3c4ccc(OSP(I)I)cc4CC[C@@H]3c3ccccc3)cc2)C1 |
| InChI | InChI=1S/C28H28F2I2NO2PS/c29-28(30)22-17-33(18-22)14-15-34-23-9-6-20(7-10-23)27-25(19-4-2-1-3-5-19)12-8-21-16-24(11-13-26(21)27)35-37-36(31)32/h1-7,9-11,13,16,22,25,27-28H,8,12,14-15,17-18H2/t25-,27+/m1/s1 |
| InChIKey | WPCGSMJTFILVEF-VPUSJEBWSA-N |
| XLogP | 9.25 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.38 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|