C22H18FN7O8 — CID 129126439
5-fluoro-2-[1,2,2,3,3,3-hexahydroxy-1-[(8-oxo-7,9-dihydropurin-6-yl)amino]propyl]-3-phenylquinazolin-4-one (PubChem CID 129126439) has the molecular formula C22H18FN7O8 and a molecular weight of 527.43 g/mol. Its IUPAC name is 5-fluoro-2-[1,2,2,3,3,3-hexahydroxy-1-[(8-oxo-7,9-dihydropurin-6-yl)amino]propyl]-3-phenylquinazolin-4-one.
| Compound Name | 5-fluoro-2-[1,2,2,3,3,3-hexahydroxy-1-[(8-oxo-7,9-dihydropurin-6-yl)amino]propyl]-3-phenylquinazolin-4-one |
|---|---|
| PubChem CID | 129126439 |
| Molecular Formula | C22H18FN7O8 |
| Molecular Weight | 527.43 g/mol |
| Exact Mass | 527.12 |
| IUPAC Name | 5-fluoro-2-[1,2,2,3,3,3-hexahydroxy-1-[(8-oxo-7,9-dihydropurin-6-yl)amino]propyl]-3-phenylquinazolin-4-one |
| SMILES | O=c1[nH]c2ncnc(NC(O)(c3nc4cccc(F)c4c(=O)n3-c3ccccc3)C(O)(O)C(O)(O)O)c2[nH]1 |
| InChI | InChI=1S/C22H18FN7O8/c23-11-7-4-8-12-13(11)17(31)30(10-5-2-1-3-6-10)18(26-12)20(33,21(34,35)22(36,37)38)29-16-14-15(24-9-25-16)28-19(32)27-14/h1-9,33-38H,(H3,24,25,27,28,29,32) |
| InChIKey | QMPQQWVNOHTELN-UHFFFAOYSA-N |
| XLogP | -1.95 |
| TPSA | 242.73 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.43 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|