C16H24N4 — CID 129126653
2-methanimidoyl-6-[[(2R)-2,3,5-trimethyl-1,2-dihydropyridin-6-yl]methylideneamino]cyclohex-3-en-1-amine (PubChem CID 129126653) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is 2-methanimidoyl-6-[[(2R)-2,3,5-trimethyl-1,2-dihydropyridin-6-yl]methylideneamino]cyclohex-3-en-1-amine.
| Compound Name | 2-methanimidoyl-6-[[(2R)-2,3,5-trimethyl-1,2-dihydropyridin-6-yl]methylideneamino]cyclohex-3-en-1-amine |
|---|---|
| PubChem CID | 129126653 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 2-methanimidoyl-6-[[(2R)-2,3,5-trimethyl-1,2-dihydropyridin-6-yl]methylideneamino]cyclohex-3-en-1-amine |
| SMILES | [H]/N=C/C1C=CCC(/N=C/C2=C(C)C=C(C)[C@@H](C)N2)C1N |
| InChI | InChI=1S/C16H24N4/c1-10-7-11(2)15(20-12(10)3)9-19-14-6-4-5-13(8-17)16(14)18/h4-5,7-9,12-14,16-17,20H,6,18H2,1-3H3/b17-8+,19-9+/t12-,13?,14?,16?/m1/s1 |
| InChIKey | VKIXANXDAZVKKW-YZTMHWLFSA-N |
| XLogP | 2.19 |
| TPSA | 74.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|