C19H31NO — CID 129126854
(8Z)-4-tert-butyl-8-methyl-6-nitrosotetradeca-4,8-dien-1-yne (PubChem CID 129126854) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is (8Z)-4-tert-butyl-8-methyl-6-nitrosotetradeca-4,8-dien-1-yne.
| Compound Name | (8Z)-4-tert-butyl-8-methyl-6-nitrosotetradeca-4,8-dien-1-yne |
|---|---|
| PubChem CID | 129126854 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | (8Z)-4-tert-butyl-8-methyl-6-nitrosotetradeca-4,8-dien-1-yne |
| SMILES | C#CCC(=CC(C/C(C)=C\CCCCC)N=O)C(C)(C)C |
| InChI | InChI=1S/C19H31NO/c1-7-9-10-11-13-16(3)14-18(20-21)15-17(12-8-2)19(4,5)6/h2,13,15,18H,7,9-12,14H2,1,3-6H3/b16-13-,17-15? |
| InChIKey | VHNQEXUKNXBKEF-OVIREHMNSA-N |
| XLogP | 6.03 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|