About N-[(4Z)-4-ethyl-6-methylhepta-4,6-dienyl]methanimine
N-[(4Z)-4-ethyl-6-methylhepta-4,6-dienyl]methanimine (PubChem CID 129127018) has the molecular formula C11H19N
and a molecular weight of 165.28 g/mol. Its IUPAC name is N-[(4Z)-4-ethyl-6-methylhepta-4,6-dienyl]methanimine.
Molecular Properties
| Compound Name | N-[(4Z)-4-ethyl-6-methylhepta-4,6-dienyl]methanimine |
| PubChem CID | 129127018 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | N-[(4Z)-4-ethyl-6-methylhepta-4,6-dienyl]methanimine |
| SMILES | C=NCCC/C(=C\C(=C)C)CC |
| InChI | InChI=1S/C11H19N/c1-5-11(9-10(2)3)7-6-8-12-4/h9H,2,4-8H2,1,3H3/b11-9- |
| InChIKey | SWHPKWDQFPPQEG-LUAWRHEFSA-N |
| XLogP | 3.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(4Z)-4-ethyl-6-methylhepta-4,6-dienyl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4Z)-4-ethyl-6-methylhepta-4,6-dienyl]methanimine?
The IUPAC name of N-[(4Z)-4-ethyl-6-methylhepta-4,6-dienyl]methanimine (CID 129127018) is N-[(4Z)-4-ethyl-6-methylhepta-4,6-dienyl]methanimine.
What is the SMILES notation for N-[(4Z)-4-ethyl-6-methylhepta-4,6-dienyl]methanimine?
The canonical SMILES for N-[(4Z)-4-ethyl-6-methylhepta-4,6-dienyl]methanimine is C=NCCC/C(=C\C(=C)C)CC.
What is the InChIKey of N-[(4Z)-4-ethyl-6-methylhepta-4,6-dienyl]methanimine?
The InChIKey is SWHPKWDQFPPQEG-LUAWRHEFSA-N. The full InChI is InChI=1S/C11H19N/c1-5-11(9-10(2)3)7-6-8-12-4/h9H,2,4-8H2,1,3H3/b11-9-.
What are the key properties of N-[(4Z)-4-ethyl-6-methylhepta-4,6-dienyl]methanimine?
N-[(4Z)-4-ethyl-6-methylhepta-4,6-dienyl]methanimine has a molecular weight of 165.28 g/mol, XLogP of 3.38, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4Z)-4-ethyl-6-methylhepta-4,6-dienyl]methanimine is sourced from PubChem (CID 129127018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).