C19H20F2N4O — CID 129127266
4-fluoro-N-[(4R)-1-[(2E,4E)-4-fluorohexa-2,4-dien-3-yl]-4,5,6,7-tetrahydroindazol-4-yl]pyridine-2-carboxamide (PubChem CID 129127266) has the molecular formula C19H20F2N4O and a molecular weight of 358.39 g/mol. Its IUPAC name is 4-fluoro-N-[(4R)-1-[(2E,4E)-4-fluorohexa-2,4-dien-3-yl]-4,5,6,7-tetrahydroindazol-4-yl]pyridine-2-carboxamide.
| Compound Name | 4-fluoro-N-[(4R)-1-[(2E,4E)-4-fluorohexa-2,4-dien-3-yl]-4,5,6,7-tetrahydroindazol-4-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 129127266 |
| Molecular Formula | C19H20F2N4O |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 4-fluoro-N-[(4R)-1-[(2E,4E)-4-fluorohexa-2,4-dien-3-yl]-4,5,6,7-tetrahydroindazol-4-yl]pyridine-2-carboxamide |
| SMILES | C/C=C(F)\C(=C/C)n1ncc2c1CCC[C@H]2NC(=O)c1cc(F)ccn1 |
| InChI | InChI=1S/C19H20F2N4O/c1-3-14(21)17(4-2)25-18-7-5-6-15(13(18)11-23-25)24-19(26)16-10-12(20)8-9-22-16/h3-4,8-11,15H,5-7H2,1-2H3,(H,24,26)/b14-3+,17-4+/t15-/m1/s1 |
| InChIKey | LGRAUAXHSYCOTJ-GCJBXRQNSA-N |
| XLogP | 3.96 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|