C18H18Cl2N4O — CID 12912737
2-[3,6-bis(2-chlorophenyl)-4-ethyl-1,2,4,5-tetrazin-1-yl]ethanol (PubChem CID 12912737) has the molecular formula C18H18Cl2N4O and a molecular weight of 377.28 g/mol. Its IUPAC name is 2-[3,6-bis(2-chlorophenyl)-4-ethyl-1,2,4,5-tetrazin-1-yl]ethanol.
| Compound Name | 2-[3,6-bis(2-chlorophenyl)-4-ethyl-1,2,4,5-tetrazin-1-yl]ethanol |
|---|---|
| PubChem CID | 12912737 |
| Molecular Formula | C18H18Cl2N4O |
| Molecular Weight | 377.28 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 2-[3,6-bis(2-chlorophenyl)-4-ethyl-1,2,4,5-tetrazin-1-yl]ethanol |
| SMILES | CCN1N=C(c2ccccc2Cl)N(CCO)N=C1c1ccccc1Cl |
| InChI | InChI=1S/C18H18Cl2N4O/c1-2-23-17(13-7-3-5-9-15(13)19)22-24(11-12-25)18(21-23)14-8-4-6-10-16(14)20/h3-10,25H,2,11-12H2,1H3 |
| InChIKey | ZEBCDQGNOYIKII-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.28 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |